C15H26FN3O4 — CID 91616251
methyl (2S)-7-(1-aminoethylideneamino)-6-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-5-enoate (PubChem CID 91616251) has the molecular formula C15H26FN3O4 and a molecular weight of 331.39 g/mol. Its IUPAC name is methyl (2S)-7-(1-aminoethylideneamino)-6-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-5-enoate.
| Compound Name | methyl (2S)-7-(1-aminoethylideneamino)-6-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-5-enoate |
|---|---|
| PubChem CID | 91616251 |
| Molecular Formula | C15H26FN3O4 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | methyl (2S)-7-(1-aminoethylideneamino)-6-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-5-enoate |
| SMILES | COC(=O)[C@H](CCC=C(F)C/N=C(\C)N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26FN3O4/c1-10(17)18-9-11(16)7-6-8-12(13(20)22-5)19-14(21)23-15(2,3)4/h7,12H,6,8-9H2,1-5H3,(H2,17,18)(H,19,21)/t12-/m0/s1 |
| InChIKey | HOYMWUPIQJGQPP-LBPRGKRZSA-N |
| XLogP | 2.06 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|