C11H20FN3O2 — CID 91030934
methyl (2S)-2-amino-7-(1-aminoethylideneamino)-6-fluoro-2-methylhept-5-enoate (PubChem CID 91030934) has the molecular formula C11H20FN3O2 and a molecular weight of 245.30 g/mol. Its IUPAC name is methyl (2S)-2-amino-7-(1-aminoethylideneamino)-6-fluoro-2-methylhept-5-enoate.
| Compound Name | methyl (2S)-2-amino-7-(1-aminoethylideneamino)-6-fluoro-2-methylhept-5-enoate |
|---|---|
| PubChem CID | 91030934 |
| Molecular Formula | C11H20FN3O2 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | methyl (2S)-2-amino-7-(1-aminoethylideneamino)-6-fluoro-2-methylhept-5-enoate |
| SMILES | COC(=O)[C@@](C)(N)CCC=C(F)C/N=C(\C)N |
| InChI | InChI=1S/C11H20FN3O2/c1-8(13)15-7-9(12)5-4-6-11(2,14)10(16)17-3/h5H,4,6-7,14H2,1-3H3,(H2,13,15)/t11-/m0/s1 |
| InChIKey | NZLYYDOTNZUYIR-NSHDSACASA-N |
| XLogP | 0.89 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|