C9H15F2N3O2 — CID 57464321
(E,2S)-2-amino-6-(1-aminoethylideneamino)-4,5-difluoro-2-methylhex-4-enoic acid (PubChem CID 57464321) has the molecular formula C9H15F2N3O2 and a molecular weight of 235.23 g/mol. Its IUPAC name is (E,2S)-2-amino-6-(1-aminoethylideneamino)-4,5-difluoro-2-methylhex-4-enoic acid.
| Compound Name | (E,2S)-2-amino-6-(1-aminoethylideneamino)-4,5-difluoro-2-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 57464321 |
| Molecular Formula | C9H15F2N3O2 |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (E,2S)-2-amino-6-(1-aminoethylideneamino)-4,5-difluoro-2-methylhex-4-enoic acid |
| SMILES | C/C(N)=N\C/C(F)=C(\F)C[C@](C)(N)C(=O)O |
| InChI | InChI=1S/C9H15F2N3O2/c1-5(12)14-4-7(11)6(10)3-9(2,13)8(15)16/h3-4,13H2,1-2H3,(H2,12,14)(H,15,16)/b7-6+/t9-/m0/s1 |
| InChIKey | BUZWJCAEJCWJHC-UCUJLANTSA-N |
| XLogP | 0.71 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|