C8H19Cl2N3O3S — CID 10470504
2-amino-3-[2-(1-aminoethylideneamino)ethylsulfinyl]-2-methylpropanoic acid;dihydrochloride (PubChem CID 10470504) has the molecular formula C8H19Cl2N3O3S and a molecular weight of 308.23 g/mol. Its IUPAC name is 2-amino-3-[2-(1-aminoethylideneamino)ethylsulfinyl]-2-methylpropanoic acid;dihydrochloride.
| Compound Name | 2-amino-3-[2-(1-aminoethylideneamino)ethylsulfinyl]-2-methylpropanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 10470504 |
| Molecular Formula | C8H19Cl2N3O3S |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-amino-3-[2-(1-aminoethylideneamino)ethylsulfinyl]-2-methylpropanoic acid;dihydrochloride |
| SMILES | C/C(N)=N\CCS(=O)CC(C)(N)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C8H17N3O3S.2ClH/c1-6(9)11-3-4-15(14)5-8(2,10)7(12)13;;/h3-5,10H2,1-2H3,(H2,9,11)(H,12,13);2*1H |
| InChIKey | LEDHRNQAHSYGBC-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|