About 2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid
2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid (PubChem CID 72590955) has the molecular formula C12H23N3O2
and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid.
Molecular Properties
| Compound Name | 2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid |
| PubChem CID | 72590955 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid |
| SMILES | CC(CCC/N=C(\C)N)=C(C)C(C)(N)C(=O)O |
| InChI | InChI=1S/C12H23N3O2/c1-8(6-5-7-15-10(3)13)9(2)12(4,14)11(16)17/h5-7,14H2,1-4H3,(H2,13,15)(H,16,17) |
| InChIKey | AUMIMXPUKNTHLC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid?
The IUPAC name of 2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid (CID 72590955) is 2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid.
What is the SMILES notation for 2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid?
The canonical SMILES for 2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid is CC(CCC/N=C(\C)N)=C(C)C(C)(N)C(=O)O.
What is the InChIKey of 2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid?
The InChIKey is AUMIMXPUKNTHLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O2/c1-8(6-5-7-15-10(3)13)9(2)12(4,14)11(16)17/h5-7,14H2,1-4H3,(H2,13,15)(H,16,17).
What are the key properties of 2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid?
2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid has a molecular weight of 241.33 g/mol, XLogP of 1.28, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7-(1-aminoethylideneamino)-2,3,4-trimethylhept-3-enoic acid is sourced from PubChem (CID 72590955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).