C8H16N2O2 — CID 90976628
(2R)-5-(1-aminoethylideneamino)-2-methylpentanoic acid (PubChem CID 90976628) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is (2R)-5-(1-aminoethylideneamino)-2-methylpentanoic acid.
| Compound Name | (2R)-5-(1-aminoethylideneamino)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 90976628 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | (2R)-5-(1-aminoethylideneamino)-2-methylpentanoic acid |
| SMILES | C/C(N)=N\CCC[C@@H](C)C(=O)O |
| InChI | InChI=1S/C8H16N2O2/c1-6(8(11)12)4-3-5-10-7(2)9/h6H,3-5H2,1-2H3,(H2,9,10)(H,11,12)/t6-/m1/s1 |
| InChIKey | LAKBWMPGYBNMJK-ZCFIWIBFSA-N |
| XLogP | 0.86 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|