C11H24N4O — CID 159082319
5-(1-aminoethylideneamino)-2-(methylamino)-N-propylpentanamide (PubChem CID 159082319) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is 5-(1-aminoethylideneamino)-2-(methylamino)-N-propylpentanamide.
| Compound Name | 5-(1-aminoethylideneamino)-2-(methylamino)-N-propylpentanamide |
|---|---|
| PubChem CID | 159082319 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 5-(1-aminoethylideneamino)-2-(methylamino)-N-propylpentanamide |
| SMILES | CCCNC(=O)C(CCC/N=C(\C)N)NC |
| InChI | InChI=1S/C11H24N4O/c1-4-7-15-11(16)10(13-3)6-5-8-14-9(2)12/h10,13H,4-8H2,1-3H3,(H2,12,14)(H,15,16) |
| InChIKey | AQZATUARRCVBRW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|