C9H19N3O3 — CID 20638014
(2S,3S)-3-amino-7-(1-aminoethylideneamino)-2-hydroxyheptanoic acid (PubChem CID 20638014) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is (2S,3S)-3-amino-7-(1-aminoethylideneamino)-2-hydroxyheptanoic acid.
| Compound Name | (2S,3S)-3-amino-7-(1-aminoethylideneamino)-2-hydroxyheptanoic acid |
|---|---|
| PubChem CID | 20638014 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | (2S,3S)-3-amino-7-(1-aminoethylideneamino)-2-hydroxyheptanoic acid |
| SMILES | C/C(N)=N\CCCC[C@H](N)[C@H](O)C(=O)O |
| InChI | InChI=1S/C9H19N3O3/c1-6(10)12-5-3-2-4-7(11)8(13)9(14)15/h7-8,13H,2-5,11H2,1H3,(H2,10,12)(H,14,15)/t7-,8-/m0/s1 |
| InChIKey | XDGBDYCDUXHXDK-YUMQZZPRSA-N |
| XLogP | -0.69 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|