C10H21Cl2N3O2 — CID 162334607
(Z)-2-amino-7-(1-aminoethylideneamino)-4-methylhept-3-enoic acid;dihydrochloride (PubChem CID 162334607) has the molecular formula C10H21Cl2N3O2 and a molecular weight of 286.20 g/mol. Its IUPAC name is (Z)-2-amino-7-(1-aminoethylideneamino)-4-methylhept-3-enoic acid;dihydrochloride.
| Compound Name | (Z)-2-amino-7-(1-aminoethylideneamino)-4-methylhept-3-enoic acid;dihydrochloride |
|---|---|
| PubChem CID | 162334607 |
| Molecular Formula | C10H21Cl2N3O2 |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (Z)-2-amino-7-(1-aminoethylideneamino)-4-methylhept-3-enoic acid;dihydrochloride |
| SMILES | C/C(=C/C(N)C(=O)O)CCC/N=C(\C)N.Cl.Cl |
| InChI | InChI=1S/C10H19N3O2.2ClH/c1-7(6-9(12)10(14)15)4-3-5-13-8(2)11;;/h6,9H,3-5,12H2,1-2H3,(H2,11,13)(H,14,15);2*1H/b7-6-;; |
| InChIKey | QBNGBFODQMFNLO-AQTVDGORSA-N |
| XLogP | 1.35 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|