C8H16NO5P — CID 88509040
(E,2R)-2-amino-4-methyl-7-phosphonohept-3-enoic acid (PubChem CID 88509040) has the molecular formula C8H16NO5P and a molecular weight of 237.19 g/mol. Its IUPAC name is (E,2R)-2-amino-4-methyl-7-phosphonohept-3-enoic acid.
| Compound Name | (E,2R)-2-amino-4-methyl-7-phosphonohept-3-enoic acid |
|---|---|
| PubChem CID | 88509040 |
| Molecular Formula | C8H16NO5P |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (E,2R)-2-amino-4-methyl-7-phosphonohept-3-enoic acid |
| SMILES | C/C(=C\[C@@H](N)C(=O)O)CCCP(=O)(O)O |
| InChI | InChI=1S/C8H16NO5P/c1-6(5-7(9)8(10)11)3-2-4-15(12,13)14/h5,7H,2-4,9H2,1H3,(H,10,11)(H2,12,13,14)/b6-5+/t7-/m1/s1 |
| InChIKey | YKPZTHXPYPFOMI-WEWAHIQMSA-N |
| XLogP | 0.30 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|