C9H19Cl2N3O2 — CID 172867749
(Z,2S)-2-amino-7-(1-aminoethylideneamino)hept-3-enoic acid;dihydrochloride (PubChem CID 172867749) has the molecular formula C9H19Cl2N3O2 and a molecular weight of 272.18 g/mol. Its IUPAC name is (Z,2S)-2-amino-7-(1-aminoethylideneamino)hept-3-enoic acid;dihydrochloride.
| Compound Name | (Z,2S)-2-amino-7-(1-aminoethylideneamino)hept-3-enoic acid;dihydrochloride |
|---|---|
| PubChem CID | 172867749 |
| Molecular Formula | C9H19Cl2N3O2 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (Z,2S)-2-amino-7-(1-aminoethylideneamino)hept-3-enoic acid;dihydrochloride |
| SMILES | C/C(N)=N\CCC/C=C\[C@H](N)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C9H17N3O2.2ClH/c1-7(10)12-6-4-2-3-5-8(11)9(13)14;;/h3,5,8H,2,4,6,11H2,1H3,(H2,10,12)(H,13,14);2*1H/b5-3-;;/t8-;;/m0../s1 |
| InChIKey | MTRDKYLSCWGCCK-YCXSTTGSSA-N |
| XLogP | 0.96 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|