C10H23N3O3 — CID 20638021
N'-[(5S)-5-amino-6,7,8-trihydroxyoctyl]ethanimidamide (PubChem CID 20638021) has the molecular formula C10H23N3O3 and a molecular weight of 233.31 g/mol. Its IUPAC name is N'-[(5S)-5-amino-6,7,8-trihydroxyoctyl]ethanimidamide.
| Compound Name | N'-[(5S)-5-amino-6,7,8-trihydroxyoctyl]ethanimidamide |
|---|---|
| PubChem CID | 20638021 |
| Molecular Formula | C10H23N3O3 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.17 |
| IUPAC Name | N'-[(5S)-5-amino-6,7,8-trihydroxyoctyl]ethanimidamide |
| SMILES | C/C(N)=N\CCCC[C@H](N)C(O)C(O)CO |
| InChI | InChI=1S/C10H23N3O3/c1-7(11)13-5-3-2-4-8(12)10(16)9(15)6-14/h8-10,14-16H,2-6,12H2,1H3,(H2,11,13)/t8-,9?,10?/m0/s1 |
| InChIKey | AYBFPMZFKCAYDH-IDKOKCKLSA-N |
| XLogP | -1.42 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|