C21H42N6O4 — CID 142040087
2-[2-[3-amino-7-(1-aminoethylideneamino)hept-1-en-2-yl]oxyethoxy]ethyl 2-amino-6-(1-aminoethylideneamino)hexanoate (PubChem CID 142040087) has the molecular formula C21H42N6O4 and a molecular weight of 442.61 g/mol. Its IUPAC name is 2-[2-[3-amino-7-(1-aminoethylideneamino)hept-1-en-2-yl]oxyethoxy]ethyl 2-amino-6-(1-aminoethylideneamino)hexanoate.
| Compound Name | 2-[2-[3-amino-7-(1-aminoethylideneamino)hept-1-en-2-yl]oxyethoxy]ethyl 2-amino-6-(1-aminoethylideneamino)hexanoate |
|---|---|
| PubChem CID | 142040087 |
| Molecular Formula | C21H42N6O4 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | 2-[2-[3-amino-7-(1-aminoethylideneamino)hept-1-en-2-yl]oxyethoxy]ethyl 2-amino-6-(1-aminoethylideneamino)hexanoate |
| SMILES | C=C(OCCOCCOC(=O)C(N)CCCC/N=C(\C)N)C(N)CCCC/N=C(\C)N |
| InChI | InChI=1S/C21H42N6O4/c1-16(19(24)8-4-6-10-26-17(2)22)30-14-12-29-13-15-31-21(28)20(25)9-5-7-11-27-18(3)23/h19-20H,1,4-15,24-25H2,2-3H3,(H2,22,26)(H2,23,27) |
| InChIKey | SWXNTXAFVHISLB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 173.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|