C28H58N4O5S — CID 134189737
2-amino-5-(1-aminoethylideneamino)-N-[2-[2-[2-[2-(10-propan-2-ylsulfanyldecoxy)ethoxy]ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 134189737) has the molecular formula C28H58N4O5S and a molecular weight of 562.86 g/mol. Its IUPAC name is 2-amino-5-(1-aminoethylideneamino)-N-[2-[2-[2-[2-(10-propan-2-ylsulfanyldecoxy)ethoxy]ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 2-amino-5-(1-aminoethylideneamino)-N-[2-[2-[2-[2-(10-propan-2-ylsulfanyldecoxy)ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 134189737 |
| Molecular Formula | C28H58N4O5S |
| Molecular Weight | 562.86 g/mol |
| Exact Mass | 562.41 |
| IUPAC Name | 2-amino-5-(1-aminoethylideneamino)-N-[2-[2-[2-[2-(10-propan-2-ylsulfanyldecoxy)ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | C/C(N)=N\CCCC(N)C(=O)NCCOCCOCCOCCOCCCCCCCCCCSC(C)C |
| InChI | InChI=1S/C28H58N4O5S/c1-25(2)38-24-11-9-7-5-4-6-8-10-16-34-18-20-36-22-23-37-21-19-35-17-15-32-28(33)27(30)13-12-14-31-26(3)29/h25,27H,4-24,30H2,1-3H3,(H2,29,31)(H,32,33) |
| InChIKey | FHZRLKAHVSMVEV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.86 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|