C19H38BN7O7 — CID 53239222
[1-[(2R)-2-[[2-[2-[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]ethoxy]ethoxy]acetyl]amino]propanoyl]pyrrolidin-2-yl]boronic acid (PubChem CID 53239222) has the molecular formula C19H38BN7O7 and a molecular weight of 487.37 g/mol. Its IUPAC name is [1-[(2R)-2-[[2-[2-[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]ethoxy]ethoxy]acetyl]amino]propanoyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [1-[(2R)-2-[[2-[2-[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]ethoxy]ethoxy]acetyl]amino]propanoyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 53239222 |
| Molecular Formula | C19H38BN7O7 |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | [1-[(2R)-2-[[2-[2-[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]ethoxy]ethoxy]acetyl]amino]propanoyl]pyrrolidin-2-yl]boronic acid |
| SMILES | C[C@@H](NC(=O)COCCOCCNC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N1CCCC1B(O)O |
| InChI | InChI=1S/C19H38BN7O7/c1-13(18(30)27-8-3-5-15(27)20(31)32)26-16(28)12-34-11-10-33-9-7-24-17(29)14(21)4-2-6-25-19(22)23/h13-15,31-32H,2-12,21H2,1H3,(H,24,29)(H,26,28)(H4,22,23,25)/t13-,14+,15?/m1/s1 |
| InChIKey | XDESMXHYDITEMS-GNXJLENFSA-N |
| XLogP | -3.98 |
| TPSA | 227.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|