C22H45BN8O5 — CID 72550104
[(2R)-1-[(2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidin-2-yl]boronic acid (PubChem CID 72550104) has the molecular formula C22H45BN8O5 and a molecular weight of 512.47 g/mol. Its IUPAC name is [(2R)-1-[(2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[(2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 72550104 |
| Molecular Formula | C22H45BN8O5 |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.36 |
| IUPAC Name | [(2R)-1-[(2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidin-2-yl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1B(O)O |
| InChI | InChI=1S/C22H45BN8O5/c1-14(2)13-17(30-19(32)15(25)7-3-4-10-24)20(33)29-16(8-5-11-28-22(26)27)21(34)31-12-6-9-18(31)23(35)36/h14-18,35-36H,3-13,24-25H2,1-2H3,(H,29,33)(H,30,32)(H4,26,27,28)/t15-,16-,17-,18-/m0/s1 |
| InChIKey | KBSMSGKJTWSABJ-XSLAGTTESA-N |
| XLogP | -2.48 |
| TPSA | 235.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|