C25H46N8O5 — CID 140672805
(2S)-2-acetamido-6-amino-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(2S)-2-formylpyrrolidin-1-yl]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]hexanamide (PubChem CID 140672805) has the molecular formula C25H46N8O5 and a molecular weight of 538.69 g/mol. Its IUPAC name is (2S)-2-acetamido-6-amino-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(2S)-2-formylpyrrolidin-1-yl]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]hexanamide.
| Compound Name | (2S)-2-acetamido-6-amino-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(2S)-2-formylpyrrolidin-1-yl]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]hexanamide |
|---|---|
| PubChem CID | 140672805 |
| Molecular Formula | C25H46N8O5 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.36 |
| IUPAC Name | (2S)-2-acetamido-6-amino-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(2S)-2-formylpyrrolidin-1-yl]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]hexanamide |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1C=O |
| InChI | InChI=1S/C25H46N8O5/c1-16(2)14-21(32-22(36)19(30-17(3)35)9-4-5-11-26)23(37)31-20(10-6-12-29-25(27)28)24(38)33-13-7-8-18(33)15-34/h15-16,18-21H,4-14,26H2,1-3H3,(H,30,35)(H,31,37)(H,32,36)(H4,27,28,29)/t18-,19-,20-,21-/m0/s1 |
| InChIKey | XUFGCPHLBPSPCD-TUFLPTIASA-N |
| XLogP | -1.12 |
| TPSA | 215.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|