C29H44N6O7 — CID 72550988
(4S)-4-[(4-aminobenzoyl)amino]-5-[[(2S)-1-[[(2S)-6-amino-1-(2-formylpyrrolidin-1-yl)-1-oxohexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 72550988) has the molecular formula C29H44N6O7 and a molecular weight of 588.71 g/mol. Its IUPAC name is (4S)-4-[(4-aminobenzoyl)amino]-5-[[(2S)-1-[[(2S)-6-amino-1-(2-formylpyrrolidin-1-yl)-1-oxohexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[(4-aminobenzoyl)amino]-5-[[(2S)-1-[[(2S)-6-amino-1-(2-formylpyrrolidin-1-yl)-1-oxohexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 72550988 |
| Molecular Formula | C29H44N6O7 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | (4S)-4-[(4-aminobenzoyl)amino]-5-[[(2S)-1-[[(2S)-6-amino-1-(2-formylpyrrolidin-1-yl)-1-oxohexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)c1ccc(N)cc1)C(=O)N[C@@H](CCCCN)C(=O)N1CCCC1C=O |
| InChI | InChI=1S/C29H44N6O7/c1-18(2)16-24(28(41)33-23(7-3-4-14-30)29(42)35-15-5-6-21(35)17-36)34-27(40)22(12-13-25(37)38)32-26(39)19-8-10-20(31)11-9-19/h8-11,17-18,21-24H,3-7,12-16,30-31H2,1-2H3,(H,32,39)(H,33,41)(H,34,40)(H,37,38)/t21?,22-,23-,24-/m0/s1 |
| InChIKey | JDUPGJXIWZOMGE-NSBVFQKPSA-N |
| XLogP | 0.57 |
| TPSA | 214.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|