C19H35N5O6+2 — CID 137322706
[(5S)-5-[[(2S)-2-[[(2S)-2-azaniumyl-4-carboxybutanoyl]amino]propanoyl]amino]-6-[(2S)-2-formylpyrrolidin-1-yl]-6-oxohexyl]azanium (PubChem CID 137322706) has the molecular formula C19H35N5O6+2 and a molecular weight of 429.52 g/mol. Its IUPAC name is [(5S)-5-[[(2S)-2-[[(2S)-2-azaniumyl-4-carboxybutanoyl]amino]propanoyl]amino]-6-[(2S)-2-formylpyrrolidin-1-yl]-6-oxohexyl]azanium.
| Compound Name | [(5S)-5-[[(2S)-2-[[(2S)-2-azaniumyl-4-carboxybutanoyl]amino]propanoyl]amino]-6-[(2S)-2-formylpyrrolidin-1-yl]-6-oxohexyl]azanium |
|---|---|
| PubChem CID | 137322706 |
| Molecular Formula | C19H35N5O6+2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | [(5S)-5-[[(2S)-2-[[(2S)-2-azaniumyl-4-carboxybutanoyl]amino]propanoyl]amino]-6-[(2S)-2-formylpyrrolidin-1-yl]-6-oxohexyl]azanium |
| SMILES | C[C@H](NC(=O)[C@@H]([NH3+])CCC(=O)O)C(=O)N[C@@H](CCCC[NH3+])C(=O)N1CCC[C@H]1C=O |
| InChI | InChI=1S/C19H33N5O6/c1-12(22-18(29)14(21)7-8-16(26)27)17(28)23-15(6-2-3-9-20)19(30)24-10-4-5-13(24)11-25/h11-15H,2-10,20-21H2,1H3,(H,22,29)(H,23,28)(H,26,27)/p+2/t12-,13-,14-,15-/m0/s1 |
| InChIKey | RLUVVSPFGAXEAL-AJNGGQMLSA-P |
| XLogP | -2.95 |
| TPSA | 188.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|