C30H47N9O4 — CID 130405280
N-[6-amino-1-[[1-[[1-(2-cyanopyrrolidin-1-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]benzamide (PubChem CID 130405280) has the molecular formula C30H47N9O4 and a molecular weight of 597.77 g/mol. Its IUPAC name is N-[6-amino-1-[[1-[[1-(2-cyanopyrrolidin-1-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]benzamide.
| Compound Name | N-[6-amino-1-[[1-[[1-(2-cyanopyrrolidin-1-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]benzamide |
|---|---|
| PubChem CID | 130405280 |
| Molecular Formula | C30H47N9O4 |
| Molecular Weight | 597.77 g/mol |
| Exact Mass | 597.38 |
| IUPAC Name | N-[6-amino-1-[[1-[[1-(2-cyanopyrrolidin-1-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]benzamide |
| SMILES | CC(C)CC(NC(=O)C(CCCCN)NC(=O)c1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C#N |
| InChI | InChI=1S/C30H47N9O4/c1-20(2)18-25(38-27(41)23(13-6-7-15-31)36-26(40)21-10-4-3-5-11-21)28(42)37-24(14-8-16-35-30(33)34)29(43)39-17-9-12-22(39)19-32/h3-5,10-11,20,22-25H,6-9,12-18,31H2,1-2H3,(H,36,40)(H,37,42)(H,38,41)(H4,33,34,35) |
| InChIKey | CUYXZHXSRWHIJA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 221.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.77 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|