C30H50BFN6O6 — CID 140809908
[1-[(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-benzamidohexanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]-4-fluoropiperidin-2-yl]boronic acid (PubChem CID 140809908) has the molecular formula C30H50BFN6O6 and a molecular weight of 620.58 g/mol. Its IUPAC name is [1-[(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-benzamidohexanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]-4-fluoropiperidin-2-yl]boronic acid.
| Compound Name | [1-[(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-benzamidohexanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]-4-fluoropiperidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 140809908 |
| Molecular Formula | C30H50BFN6O6 |
| Molecular Weight | 620.58 g/mol |
| Exact Mass | 620.39 |
| IUPAC Name | [1-[(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-benzamidohexanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]-4-fluoropiperidin-2-yl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCCN)NC(=O)c1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)N1CCC(F)CC1B(O)O |
| InChI | InChI=1S/C30H50BFN6O6/c1-20(2)18-25(37-28(40)23(12-6-8-15-33)35-27(39)21-10-4-3-5-11-21)29(41)36-24(13-7-9-16-34)30(42)38-17-14-22(32)19-26(38)31(43)44/h3-5,10-11,20,22-26,43-44H,6-9,12-19,33-34H2,1-2H3,(H,35,39)(H,36,41)(H,37,40)/t22?,23-,24-,25-,26?/m0/s1 |
| InChIKey | MRPSTPYTCKNQLZ-YDHZEPAOSA-N |
| XLogP | 0.40 |
| TPSA | 200.11 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.58 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|