C17H28BN3O4S — CID 74765812
[(1R)-1-[[(2S)-6-amino-2-benzamidohexanoyl]amino]-3-methylsulfanylpropyl]boronic acid (PubChem CID 74765812) has the molecular formula C17H28BN3O4S and a molecular weight of 381.31 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-6-amino-2-benzamidohexanoyl]amino]-3-methylsulfanylpropyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-6-amino-2-benzamidohexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
|---|---|
| PubChem CID | 74765812 |
| Molecular Formula | C17H28BN3O4S |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [(1R)-1-[[(2S)-6-amino-2-benzamidohexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
| SMILES | CSCC[C@H](NC(=O)[C@H](CCCCN)NC(=O)c1ccccc1)B(O)O |
| InChI | InChI=1S/C17H28BN3O4S/c1-26-12-10-15(18(24)25)21-17(23)14(9-5-6-11-19)20-16(22)13-7-3-2-4-8-13/h2-4,7-8,14-15,24-25H,5-6,9-12,19H2,1H3,(H,20,22)(H,21,23)/t14-,15-/m0/s1 |
| InChIKey | WEDRWRJEEZVIIU-GJZGRUSLSA-N |
| XLogP | 0.16 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|