C21H31BN4O5S — CID 74765752
[(1R)-1-[[(2S)-6-amino-2-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid (PubChem CID 74765752) has the molecular formula C21H31BN4O5S and a molecular weight of 462.38 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-6-amino-2-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-6-amino-2-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
|---|---|
| PubChem CID | 74765752 |
| Molecular Formula | C21H31BN4O5S |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | [(1R)-1-[[(2S)-6-amino-2-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
| SMILES | CSCC[C@H](NC(=O)[C@H](CCCCN)NC(=O)c1c(-c2ccccc2)noc1C)B(O)O |
| InChI | InChI=1S/C21H31BN4O5S/c1-14-18(19(26-31-14)15-8-4-3-5-9-15)21(28)24-16(10-6-7-12-23)20(27)25-17(22(29)30)11-13-32-2/h3-5,8-9,16-17,29-30H,6-7,10-13,23H2,1-2H3,(H,24,28)(H,25,27)/t16-,17-/m0/s1 |
| InChIKey | OISPTKWKZMAKIJ-IRXDYDNUSA-N |
| XLogP | 1.13 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|