C17H29BN4O4S — CID 74765801
[(1R)-1-[[(2S)-6-amino-2-[(2-pyridin-2-ylacetyl)amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid (PubChem CID 74765801) has the molecular formula C17H29BN4O4S and a molecular weight of 396.32 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-6-amino-2-[(2-pyridin-2-ylacetyl)amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-6-amino-2-[(2-pyridin-2-ylacetyl)amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
|---|---|
| PubChem CID | 74765801 |
| Molecular Formula | C17H29BN4O4S |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [(1R)-1-[[(2S)-6-amino-2-[(2-pyridin-2-ylacetyl)amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
| SMILES | CSCC[C@H](NC(=O)[C@H](CCCCN)NC(=O)Cc1ccccn1)B(O)O |
| InChI | InChI=1S/C17H29BN4O4S/c1-27-11-8-15(18(25)26)22-17(24)14(7-2-4-9-19)21-16(23)12-13-6-3-5-10-20-13/h3,5-6,10,14-15,25-26H,2,4,7-9,11-12,19H2,1H3,(H,21,23)(H,22,24)/t14-,15-/m0/s1 |
| InChIKey | LZBGSRDTFIMIED-GJZGRUSLSA-N |
| XLogP | -0.51 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|