C26H34BN3O4S — CID 74765746
[(1R)-1-[[(2S)-6-amino-2-[(2-phenanthren-9-ylacetyl)amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid (PubChem CID 74765746) has the molecular formula C26H34BN3O4S and a molecular weight of 495.45 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-6-amino-2-[(2-phenanthren-9-ylacetyl)amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-6-amino-2-[(2-phenanthren-9-ylacetyl)amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
|---|---|
| PubChem CID | 74765746 |
| Molecular Formula | C26H34BN3O4S |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | [(1R)-1-[[(2S)-6-amino-2-[(2-phenanthren-9-ylacetyl)amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
| SMILES | CSCC[C@H](NC(=O)[C@H](CCCCN)NC(=O)Cc1cc2ccccc2c2ccccc12)B(O)O |
| InChI | InChI=1S/C26H34BN3O4S/c1-35-15-13-24(27(33)34)30-26(32)23(12-6-7-14-28)29-25(31)17-19-16-18-8-2-3-9-20(18)22-11-5-4-10-21(19)22/h2-5,8-11,16,23-24,33-34H,6-7,12-15,17,28H2,1H3,(H,29,31)(H,30,32)/t23-,24-/m0/s1 |
| InChIKey | MODTWFQGOXTOFQ-ZEQRLZLVSA-N |
| XLogP | 2.40 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|