C18H29BFN3O4S — CID 74765834
[(1R)-1-[[(2S)-6-amino-2-[[2-(4-fluorophenyl)acetyl]amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid (PubChem CID 74765834) has the molecular formula C18H29BFN3O4S and a molecular weight of 413.32 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-6-amino-2-[[2-(4-fluorophenyl)acetyl]amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-6-amino-2-[[2-(4-fluorophenyl)acetyl]amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
|---|---|
| PubChem CID | 74765834 |
| Molecular Formula | C18H29BFN3O4S |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [(1R)-1-[[(2S)-6-amino-2-[[2-(4-fluorophenyl)acetyl]amino]hexanoyl]amino]-3-methylsulfanylpropyl]boronic acid |
| SMILES | CSCC[C@H](NC(=O)[C@H](CCCCN)NC(=O)Cc1ccc(F)cc1)B(O)O |
| InChI | InChI=1S/C18H29BFN3O4S/c1-28-11-9-16(19(26)27)23-18(25)15(4-2-3-10-21)22-17(24)12-13-5-7-14(20)8-6-13/h5-8,15-16,26-27H,2-4,9-12,21H2,1H3,(H,22,24)(H,23,25)/t15-,16-/m0/s1 |
| InChIKey | XDXBSQUBLXMAQX-HOTGVXAUSA-N |
| XLogP | 0.23 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|