C17H31N5O7S — CID 18489682
2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]butanedioic acid (PubChem CID 18489682) has the molecular formula C17H31N5O7S and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]butanedioic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18489682 |
| Molecular Formula | C17H31N5O7S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]butanedioic acid |
| SMILES | CSCCC(NC(=O)CN)C(=O)NC(CCCCN)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H31N5O7S/c1-30-7-5-11(20-13(23)9-19)16(27)21-10(4-2-3-6-18)15(26)22-12(17(28)29)8-14(24)25/h10-12H,2-9,18-19H2,1H3,(H,20,23)(H,21,27)(H,22,26)(H,24,25)(H,28,29) |
| InChIKey | QPOIYUQLVGMXCL-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|