C29H35N5O5S — CID 167151332
6-amino-2-[[(2R)-2-[[2-[(2-naphthalen-2-ylacetyl)amino]-3-pyridin-2-ylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid (PubChem CID 167151332) has the molecular formula C29H35N5O5S and a molecular weight of 565.70 g/mol. Its IUPAC name is 6-amino-2-[[(2R)-2-[[2-[(2-naphthalen-2-ylacetyl)amino]-3-pyridin-2-ylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[(2R)-2-[[2-[(2-naphthalen-2-ylacetyl)amino]-3-pyridin-2-ylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 167151332 |
| Molecular Formula | C29H35N5O5S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 6-amino-2-[[(2R)-2-[[2-[(2-naphthalen-2-ylacetyl)amino]-3-pyridin-2-ylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)[C@H](CS)NC(=O)C(Cc1ccccn1)NC(=O)Cc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C29H35N5O5S/c30-13-5-3-10-23(29(38)39)33-28(37)25(18-40)34-27(36)24(17-22-9-4-6-14-31-22)32-26(35)16-19-11-12-20-7-1-2-8-21(20)15-19/h1-2,4,6-9,11-12,14-15,23-25,40H,3,5,10,13,16-18,30H2,(H,32,35)(H,33,37)(H,34,36)(H,38,39)/t23?,24?,25-/m0/s1 |
| InChIKey | FTOOKXGBDBBPOS-STEQJIOHSA-N |
| XLogP | 1.62 |
| TPSA | 163.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|