C18H30N4O3 — CID 19027342
tert-butyl N-[6-amino-1-oxo-1-(2-pyridin-2-ylethylamino)hexan-2-yl]carbamate (PubChem CID 19027342) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl N-[6-amino-1-oxo-1-(2-pyridin-2-ylethylamino)hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[6-amino-1-oxo-1-(2-pyridin-2-ylethylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 19027342 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | tert-butyl N-[6-amino-1-oxo-1-(2-pyridin-2-ylethylamino)hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCCCN)C(=O)NCCc1ccccn1 |
| InChI | InChI=1S/C18H30N4O3/c1-18(2,3)25-17(24)22-15(9-4-6-11-19)16(23)21-13-10-14-8-5-7-12-20-14/h5,7-8,12,15H,4,6,9-11,13,19H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | XGGMMMIJVBLURD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|