C26H44N6O4 — CID 91051044
2-phenylethyl 2-amino-4-[2-[2-amino-6-(1-aminoethylideneamino)hexanoyl]oxyethyl]-6-(1-aminoethylideneamino)hexanoate (PubChem CID 91051044) has the molecular formula C26H44N6O4 and a molecular weight of 504.68 g/mol. Its IUPAC name is 2-phenylethyl 2-amino-4-[2-[2-amino-6-(1-aminoethylideneamino)hexanoyl]oxyethyl]-6-(1-aminoethylideneamino)hexanoate.
| Compound Name | 2-phenylethyl 2-amino-4-[2-[2-amino-6-(1-aminoethylideneamino)hexanoyl]oxyethyl]-6-(1-aminoethylideneamino)hexanoate |
|---|---|
| PubChem CID | 91051044 |
| Molecular Formula | C26H44N6O4 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | 2-phenylethyl 2-amino-4-[2-[2-amino-6-(1-aminoethylideneamino)hexanoyl]oxyethyl]-6-(1-aminoethylideneamino)hexanoate |
| SMILES | C/C(N)=N\CCCCC(N)C(=O)OCCC(CC/N=C(\C)N)CC(N)C(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C26H44N6O4/c1-19(27)31-14-7-6-10-23(29)25(33)35-17-13-22(11-15-32-20(2)28)18-24(30)26(34)36-16-12-21-8-4-3-5-9-21/h3-5,8-9,22-24H,6-7,10-18,29-30H2,1-2H3,(H2,27,31)(H2,28,32) |
| InChIKey | FIHALUOZSGPTTO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 181.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|