C10H22N8O — CID 142831909
2-amino-N-[(E)-N-[(Z)-aminodiazenyl]-C-methylcarbonimidoyl]-6-(1-aminoethylideneamino)hexanamide (PubChem CID 142831909) has the molecular formula C10H22N8O and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-amino-N-[(E)-N-[(Z)-aminodiazenyl]-C-methylcarbonimidoyl]-6-(1-aminoethylideneamino)hexanamide.
| Compound Name | 2-amino-N-[(E)-N-[(Z)-aminodiazenyl]-C-methylcarbonimidoyl]-6-(1-aminoethylideneamino)hexanamide |
|---|---|
| PubChem CID | 142831909 |
| Molecular Formula | C10H22N8O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 2-amino-N-[(E)-N-[(Z)-aminodiazenyl]-C-methylcarbonimidoyl]-6-(1-aminoethylideneamino)hexanamide |
| SMILES | C/C(N)=N\CCCCC(N)C(=O)N/C(C)=N/N=N\N |
| InChI | InChI=1S/C10H22N8O/c1-7(11)14-6-4-3-5-9(12)10(19)15-8(2)16-18-17-13/h9H,3-6,12H2,1-2H3,(H2,11,14)(H2,13,18)(H,15,16,17,19) |
| InChIKey | QHLJPAGQFYEPAF-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 156.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|