C10H21N3O2 — CID 157301795
(Z)-2-amino-6-(1-aminoethylideneamino)-2-methylhex-4-enoic acid;methane (PubChem CID 157301795) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is (Z)-2-amino-6-(1-aminoethylideneamino)-2-methylhex-4-enoic acid;methane.
| Compound Name | (Z)-2-amino-6-(1-aminoethylideneamino)-2-methylhex-4-enoic acid;methane |
|---|---|
| PubChem CID | 157301795 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | (Z)-2-amino-6-(1-aminoethylideneamino)-2-methylhex-4-enoic acid;methane |
| SMILES | C.C/C(N)=N\C/C=C\CC(C)(N)C(=O)O |
| InChI | InChI=1S/C9H17N3O2.CH4/c1-7(10)12-6-4-3-5-9(2,11)8(13)14;/h3-4H,5-6,11H2,1-2H3,(H2,10,12)(H,13,14);1H4/b4-3-; |
| InChIKey | BBZIUHURJSBIRE-LNKPDPKZSA-N |
| XLogP | 0.75 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|