C9H20N4O2 — CID 158680059
(E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane (PubChem CID 158680059) has the molecular formula C9H20N4O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane.
| Compound Name | (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane |
|---|---|
| PubChem CID | 158680059 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane |
| SMILES | C.C/C(N)=N\C/C=C/CC(N)(N)C(=O)O |
| InChI | InChI=1S/C8H16N4O2.CH4/c1-6(9)12-5-3-2-4-8(10,11)7(13)14;/h2-3H,4-5,10-11H2,1H3,(H2,9,12)(H,13,14);1H4/b3-2+; |
| InChIKey | IEZSLEOURQQXBZ-SQQVDAMQSA-N |
| XLogP | -0.36 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|