About (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane
(E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane (PubChem CID 158680059) has the molecular formula C9H20N4O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane.
Molecular Properties
| Compound Name | (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane |
| PubChem CID | 158680059 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane |
| SMILES | C.C/C(N)=N\C/C=C/CC(N)(N)C(=O)O |
| InChI | InChI=1S/C8H16N4O2.CH4/c1-6(9)12-5-3-2-4-8(10,11)7(13)14;/h2-3H,4-5,10-11H2,1H3,(H2,9,12)(H,13,14);1H4/b3-2+; |
| InChIKey | IEZSLEOURQQXBZ-SQQVDAMQSA-N |
| XLogP | -0.36 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane?
The IUPAC name of (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane (CID 158680059) is (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane.
What is the SMILES notation for (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane?
The canonical SMILES for (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane is C.C/C(N)=N\C/C=C/CC(N)(N)C(=O)O.
What is the InChIKey of (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane?
The InChIKey is IEZSLEOURQQXBZ-SQQVDAMQSA-N. The full InChI is InChI=1S/C8H16N4O2.CH4/c1-6(9)12-5-3-2-4-8(10,11)7(13)14;/h2-3H,4-5,10-11H2,1H3,(H2,9,12)(H,13,14);1H4/b3-2+;.
What are the key properties of (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane?
(E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane has a molecular weight of 216.28 g/mol, XLogP of -0.36, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,2-diamino-6-(1-aminoethylideneamino)hex-4-enoic acid;methane is sourced from PubChem (CID 158680059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).