C10H18N3O2- — CID 22314568
(E)-2-amino-7-(1-aminoethylideneamino)-2-methylhept-5-enoate (PubChem CID 22314568) has the molecular formula C10H18N3O2- and a molecular weight of 212.27 g/mol. Its IUPAC name is (E)-2-amino-7-(1-aminoethylideneamino)-2-methylhept-5-enoate.
| Compound Name | (E)-2-amino-7-(1-aminoethylideneamino)-2-methylhept-5-enoate |
|---|---|
| PubChem CID | 22314568 |
| Molecular Formula | C10H18N3O2- |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (E)-2-amino-7-(1-aminoethylideneamino)-2-methylhept-5-enoate |
| SMILES | C/C(N)=N\C/C=C/CCC(C)(N)C(=O)[O-] |
| InChI | InChI=1S/C10H19N3O2/c1-8(11)13-7-5-3-4-6-10(2,12)9(14)15/h3,5H,4,6-7,12H2,1-2H3,(H2,11,13)(H,14,15)/p-1/b5-3+ |
| InChIKey | XRYVIWRHMIMIDT-HWKANZROSA-M |
| XLogP | -0.83 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|