About methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride
methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride (PubChem CID 175236282) has the molecular formula C11H22Cl2FN3O2
and a molecular weight of 318.22 g/mol. Its IUPAC name is methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride.
Molecular Properties
| Compound Name | methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride |
| PubChem CID | 175236282 |
| Molecular Formula | C11H22Cl2FN3O2 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride |
| SMILES | COC(=O)C(C)(N)CCC(F)=CC/N=C(\C)N.Cl.Cl |
| InChI | InChI=1S/C11H20FN3O2.2ClH/c1-8(13)15-7-5-9(12)4-6-11(2,14)10(16)17-3;;/h5H,4,6-7,14H2,1-3H3,(H2,13,15);2*1H |
| InChIKey | GDPOFQNZMVUPTB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride?
The IUPAC name of methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride (CID 175236282) is methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride.
What is the SMILES notation for methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride?
The canonical SMILES for methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride is COC(=O)C(C)(N)CCC(F)=CC/N=C(\C)N.Cl.Cl.
What is the InChIKey of methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride?
The InChIKey is GDPOFQNZMVUPTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20FN3O2.2ClH/c1-8(13)15-7-5-9(12)4-6-11(2,14)10(16)17-3;;/h5H,4,6-7,14H2,1-3H3,(H2,13,15);2*1H.
What are the key properties of methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride?
methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride has a molecular weight of 318.22 g/mol, XLogP of 1.73, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-7-(1-aminoethylideneamino)-5-fluoro-2-methylhept-5-enoate;dihydrochloride is sourced from PubChem (CID 175236282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).