C13H19FN2O4 — CID 74047288
methyl 2-amino-6-fluoro-2-methyl-7-(3-methyl-5-oxo-4H-1,2-oxazol-4-yl)hept-5-enoate (PubChem CID 74047288) has the molecular formula C13H19FN2O4 and a molecular weight of 286.30 g/mol. Its IUPAC name is methyl 2-amino-6-fluoro-2-methyl-7-(3-methyl-5-oxo-4H-1,2-oxazol-4-yl)hept-5-enoate.
| Compound Name | methyl 2-amino-6-fluoro-2-methyl-7-(3-methyl-5-oxo-4H-1,2-oxazol-4-yl)hept-5-enoate |
|---|---|
| PubChem CID | 74047288 |
| Molecular Formula | C13H19FN2O4 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | methyl 2-amino-6-fluoro-2-methyl-7-(3-methyl-5-oxo-4H-1,2-oxazol-4-yl)hept-5-enoate |
| SMILES | COC(=O)C(C)(N)CCC=C(F)CC1C(=O)ON=C1C |
| InChI | InChI=1S/C13H19FN2O4/c1-8-10(11(17)20-16-8)7-9(14)5-4-6-13(2,15)12(18)19-3/h5,10H,4,6-7,15H2,1-3H3 |
| InChIKey | IMQNHCLQNHCWAK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|