C11H21N3O2 — CID 141051437
methyl (E)-2-amino-7-(2-iminoethylamino)-2-methylhept-5-enoate (PubChem CID 141051437) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is methyl (E)-2-amino-7-(2-iminoethylamino)-2-methylhept-5-enoate.
| Compound Name | methyl (E)-2-amino-7-(2-iminoethylamino)-2-methylhept-5-enoate |
|---|---|
| PubChem CID | 141051437 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | methyl (E)-2-amino-7-(2-iminoethylamino)-2-methylhept-5-enoate |
| SMILES | [H]/N=C/CNC/C=C/CCC(C)(N)C(=O)OC |
| InChI | InChI=1S/C11H21N3O2/c1-11(13,10(15)16-2)6-4-3-5-8-14-9-7-12/h3,5,7,12,14H,4,6,8-9,13H2,1-2H3/b5-3+,12-7+ |
| InChIKey | DXMPZUWRWUTPBN-PPRDQHCASA-N |
| XLogP | 0.45 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|