C8H17N3O4S — CID 87946664
(2R)-2-amino-3-[2-(2-iminoethylamino)ethylsulfonyl]-2-methylpropanoic acid (PubChem CID 87946664) has the molecular formula C8H17N3O4S and a molecular weight of 251.31 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-(2-iminoethylamino)ethylsulfonyl]-2-methylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[2-(2-iminoethylamino)ethylsulfonyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 87946664 |
| Molecular Formula | C8H17N3O4S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (2R)-2-amino-3-[2-(2-iminoethylamino)ethylsulfonyl]-2-methylpropanoic acid |
| SMILES | [H]/N=C/CNCCS(=O)(=O)C[C@](C)(N)C(=O)O |
| InChI | InChI=1S/C8H17N3O4S/c1-8(10,7(12)13)6-16(14,15)5-4-11-3-2-9/h2,9,11H,3-6,10H2,1H3,(H,12,13)/b9-2+/t8-/m0/s1 |
| InChIKey | KDWXIEXNOAQMNY-OPOJIDBRSA-N |
| XLogP | -1.56 |
| TPSA | 133.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|