C12H26FN3O2 — CID 142831813
N'-[(E)-6-amino-2-fluorohept-2-enyl]ethanimidamide;ethane;formic acid (PubChem CID 142831813) has the molecular formula C12H26FN3O2 and a molecular weight of 263.36 g/mol. Its IUPAC name is N'-[(E)-6-amino-2-fluorohept-2-enyl]ethanimidamide;ethane;formic acid.
| Compound Name | N'-[(E)-6-amino-2-fluorohept-2-enyl]ethanimidamide;ethane;formic acid |
|---|---|
| PubChem CID | 142831813 |
| Molecular Formula | C12H26FN3O2 |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | N'-[(E)-6-amino-2-fluorohept-2-enyl]ethanimidamide;ethane;formic acid |
| SMILES | C/C(N)=N\C/C(F)=C\CCC(C)N.CC.O=CO |
| InChI | InChI=1S/C9H18FN3.C2H6.CH2O2/c1-7(11)4-3-5-9(10)6-13-8(2)12;1-2;2-1-3/h5,7H,3-4,6,11H2,1-2H3,(H2,12,13);1-2H3;1H,(H,2,3)/b9-5+;; |
| InChIKey | XMWKIBKJHKEZLJ-KJDUPKRESA-N |
| XLogP | 2.07 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|