C9H16FN3O3 — CID 59888634
(E)-2-amino-6-fluoro-7-[1-(hydroxyamino)ethylideneamino]hept-5-enoic acid (PubChem CID 59888634) has the molecular formula C9H16FN3O3 and a molecular weight of 233.24 g/mol. Its IUPAC name is (E)-2-amino-6-fluoro-7-[1-(hydroxyamino)ethylideneamino]hept-5-enoic acid.
| Compound Name | (E)-2-amino-6-fluoro-7-[1-(hydroxyamino)ethylideneamino]hept-5-enoic acid |
|---|---|
| PubChem CID | 59888634 |
| Molecular Formula | C9H16FN3O3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (E)-2-amino-6-fluoro-7-[1-(hydroxyamino)ethylideneamino]hept-5-enoic acid |
| SMILES | C/C(=N\C/C(F)=C\CCC(N)C(=O)O)NO |
| InChI | InChI=1S/C9H16FN3O3/c1-6(13-16)12-5-7(10)3-2-4-8(11)9(14)15/h3,8,16H,2,4-5,11H2,1H3,(H,12,13)(H,14,15)/b7-3+ |
| InChIKey | ZLBLGYXDADNGOG-XVNBXDOJSA-N |
| XLogP | 0.43 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|