C11H18N2O5 — CID 137348558
(2S)-2-amino-6-[(1-carboxy-3-oxobutylidene)amino]hexanoic acid (PubChem CID 137348558) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is (2S)-2-amino-6-[(1-carboxy-3-oxobutylidene)amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[(1-carboxy-3-oxobutylidene)amino]hexanoic acid |
|---|---|
| PubChem CID | 137348558 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (2S)-2-amino-6-[(1-carboxy-3-oxobutylidene)amino]hexanoic acid |
| SMILES | CC(=O)C/C(=N\CCCC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H18N2O5/c1-7(14)6-9(11(17)18)13-5-3-2-4-8(12)10(15)16/h8H,2-6,12H2,1H3,(H,15,16)(H,17,18)/b13-9+/t8-/m0/s1 |
| InChIKey | ODHRWAKMKXIGDP-AXPYHWFSSA-N |
| XLogP | 0.07 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|