C8H15N3O2S — CID 146263248
2-amino-5-[(1-amino-2-sulfanylidenepropylidene)amino]pentanoic acid (PubChem CID 146263248) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-amino-5-[(1-amino-2-sulfanylidenepropylidene)amino]pentanoic acid.
| Compound Name | 2-amino-5-[(1-amino-2-sulfanylidenepropylidene)amino]pentanoic acid |
|---|---|
| PubChem CID | 146263248 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-amino-5-[(1-amino-2-sulfanylidenepropylidene)amino]pentanoic acid |
| SMILES | CC(=S)/C(N)=N\CCCC(N)C(=O)O |
| InChI | InChI=1S/C8H15N3O2S/c1-5(14)7(10)11-4-2-3-6(9)8(12)13/h6H,2-4,9H2,1H3,(H2,10,11)(H,12,13) |
| InChIKey | OROBXTDVIWKZGN-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|