C6H13N4O3P — CID 118548738
2-amino-5-[[amino-(phosphorosoamino)methylidene]amino]pentanoic acid (PubChem CID 118548738) has the molecular formula C6H13N4O3P and a molecular weight of 220.17 g/mol. Its IUPAC name is 2-amino-5-[[amino-(phosphorosoamino)methylidene]amino]pentanoic acid.
| Compound Name | 2-amino-5-[[amino-(phosphorosoamino)methylidene]amino]pentanoic acid |
|---|---|
| PubChem CID | 118548738 |
| Molecular Formula | C6H13N4O3P |
| Molecular Weight | 220.17 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-amino-5-[[amino-(phosphorosoamino)methylidene]amino]pentanoic acid |
| SMILES | N/C(=N\CCCC(N)C(=O)O)NP=O |
| InChI | InChI=1S/C6H13N4O3P/c7-4(5(11)12)2-1-3-9-6(8)10-14-13/h4H,1-3,7H2,(H,11,12)(H3,8,9,10,13) |
| InChIKey | DWYSOBBIVWILKB-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.17 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|