C6H14N4O2S — CID 138712746
(2S)-2-amino-5-[[amino-(sulfanylamino)methylidene]amino]pentanoic acid (PubChem CID 138712746) has the molecular formula C6H14N4O2S and a molecular weight of 206.27 g/mol. Its IUPAC name is (2S)-2-amino-5-[[amino-(sulfanylamino)methylidene]amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[amino-(sulfanylamino)methylidene]amino]pentanoic acid |
|---|---|
| PubChem CID | 138712746 |
| Molecular Formula | C6H14N4O2S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (2S)-2-amino-5-[[amino-(sulfanylamino)methylidene]amino]pentanoic acid |
| SMILES | N/C(=N\CCC[C@H](N)C(=O)O)NS |
| InChI | InChI=1S/C6H14N4O2S/c7-4(5(11)12)2-1-3-9-6(8)10-13/h4,13H,1-3,7H2,(H,11,12)(H3,8,9,10)/t4-/m0/s1 |
| InChIKey | GVZMOPWOOCBXJC-BYPYZUCNSA-N |
| XLogP | -1.07 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|