C9H16FNO2 — CID 102213570
(Z,2S)-2-amino-8-fluoronon-7-enoic acid (PubChem CID 102213570) has the molecular formula C9H16FNO2 and a molecular weight of 189.23 g/mol. Its IUPAC name is (Z,2S)-2-amino-8-fluoronon-7-enoic acid.
| Compound Name | (Z,2S)-2-amino-8-fluoronon-7-enoic acid |
|---|---|
| PubChem CID | 102213570 |
| Molecular Formula | C9H16FNO2 |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (Z,2S)-2-amino-8-fluoronon-7-enoic acid |
| SMILES | C/C(F)=C/CCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H16FNO2/c1-7(10)5-3-2-4-6-8(11)9(12)13/h5,8H,2-4,6,11H2,1H3,(H,12,13)/b7-5-/t8-/m0/s1 |
| InChIKey | ZCHLZJNEHGJRSV-TVSKSKRASA-N |
| XLogP | 1.83 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|