C14H29FN4O4 — CID 158911714
(Z)-2-amino-7-(1-aminoethylideneamino)-5-fluorohept-4-enoic acid;(2S)-2-(methylamino)butane-1,4-diol (PubChem CID 158911714) has the molecular formula C14H29FN4O4 and a molecular weight of 336.41 g/mol. Its IUPAC name is (Z)-2-amino-7-(1-aminoethylideneamino)-5-fluorohept-4-enoic acid;(2S)-2-(methylamino)butane-1,4-diol.
| Compound Name | (Z)-2-amino-7-(1-aminoethylideneamino)-5-fluorohept-4-enoic acid;(2S)-2-(methylamino)butane-1,4-diol |
|---|---|
| PubChem CID | 158911714 |
| Molecular Formula | C14H29FN4O4 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (Z)-2-amino-7-(1-aminoethylideneamino)-5-fluorohept-4-enoic acid;(2S)-2-(methylamino)butane-1,4-diol |
| SMILES | C/C(N)=N\CC/C(F)=C/CC(N)C(=O)O.CN[C@H](CO)CCO |
| InChI | InChI=1S/C9H16FN3O2.C5H13NO2/c1-6(11)13-5-4-7(10)2-3-8(12)9(14)15;1-6-5(4-8)2-3-7/h2,8H,3-5,12H2,1H3,(H2,11,13)(H,14,15);5-8H,2-4H2,1H3/b7-2-;/t;5-/m.0/s1 |
| InChIKey | JGSSBYODUUYXCB-NYXHQTMSSA-N |
| XLogP | -0.64 |
| TPSA | 154.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|