C8H20N3O6PS — CID 85040284
2-amino-4-[2-(1-aminoethylideneamino)ethylsulfanyl]butanoic acid;phosphoric acid (PubChem CID 85040284) has the molecular formula C8H20N3O6PS and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-amino-4-[2-(1-aminoethylideneamino)ethylsulfanyl]butanoic acid;phosphoric acid.
| Compound Name | 2-amino-4-[2-(1-aminoethylideneamino)ethylsulfanyl]butanoic acid;phosphoric acid |
|---|---|
| PubChem CID | 85040284 |
| Molecular Formula | C8H20N3O6PS |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-amino-4-[2-(1-aminoethylideneamino)ethylsulfanyl]butanoic acid;phosphoric acid |
| SMILES | C/C(N)=N\CCSCCC(N)C(=O)O.O=P(O)(O)O |
| InChI | InChI=1S/C8H17N3O2S.H3O4P/c1-6(9)11-3-5-14-4-2-7(10)8(12)13;1-5(2,3)4/h7H,2-5,10H2,1H3,(H2,9,11)(H,12,13);(H3,1,2,3,4) |
| InChIKey | CNNHVSBCHOIDCA-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 179.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|