C8H14F3N3O2 — CID 10130993
2-amino-5-(1-aminoethylideneamino)-3-(trifluoromethyl)pentanoic acid (PubChem CID 10130993) has the molecular formula C8H14F3N3O2 and a molecular weight of 241.21 g/mol. Its IUPAC name is 2-amino-5-(1-aminoethylideneamino)-3-(trifluoromethyl)pentanoic acid.
| Compound Name | 2-amino-5-(1-aminoethylideneamino)-3-(trifluoromethyl)pentanoic acid |
|---|---|
| PubChem CID | 10130993 |
| Molecular Formula | C8H14F3N3O2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-amino-5-(1-aminoethylideneamino)-3-(trifluoromethyl)pentanoic acid |
| SMILES | C/C(N)=N\CCC(C(N)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O2/c1-4(12)14-3-2-5(8(9,10)11)6(13)7(15)16/h5-6H,2-3,13H2,1H3,(H2,12,14)(H,15,16) |
| InChIKey | KZUMELWZDWVKIF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|