About (2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid
(2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid (PubChem CID 141104063) has the molecular formula C14H30N4O2
and a molecular weight of 286.42 g/mol. Its IUPAC name is (2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid |
| PubChem CID | 141104063 |
| Molecular Formula | C14H30N4O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | (2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid |
| SMILES | CC(C)(C)C(CC([C@H](N)C(=O)O)C(C)(C)C)N=C(N)N |
| InChI | InChI=1S/C14H30N4O2/c1-13(2,3)8(10(15)11(19)20)7-9(14(4,5)6)18-12(16)17/h8-10H,7,15H2,1-6H3,(H,19,20)(H4,16,17,18)/t8?,9?,10-/m0/s1 |
| InChIKey | ACLIYSRIMHJPJK-RTBKNWGFSA-N |
| XLogP | 1.14 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid?
The IUPAC name of (2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid (CID 141104063) is (2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid.
What is the SMILES notation for (2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid?
The canonical SMILES for (2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid is CC(C)(C)C(CC([C@H](N)C(=O)O)C(C)(C)C)N=C(N)N.
What is the InChIKey of (2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid?
The InChIKey is ACLIYSRIMHJPJK-RTBKNWGFSA-N. The full InChI is InChI=1S/C14H30N4O2/c1-13(2,3)8(10(15)11(19)20)7-9(14(4,5)6)18-12(16)17/h8-10H,7,15H2,1-6H3,(H,19,20)(H4,16,17,18)/t8?,9?,10-/m0/s1.
What are the key properties of (2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid?
(2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid has a molecular weight of 286.42 g/mol, XLogP of 1.14, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-tert-butyl-5-(diaminomethylideneamino)-6,6-dimethylheptanoic acid is sourced from PubChem (CID 141104063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).