C13H17F3N4O4S — CID 175159820
2-(benzenesulfonamido)-5-(diaminomethylideneamino)-3-(trifluoromethyl)pentanoic acid (PubChem CID 175159820) has the molecular formula C13H17F3N4O4S and a molecular weight of 382.36 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-5-(diaminomethylideneamino)-3-(trifluoromethyl)pentanoic acid.
| Compound Name | 2-(benzenesulfonamido)-5-(diaminomethylideneamino)-3-(trifluoromethyl)pentanoic acid |
|---|---|
| PubChem CID | 175159820 |
| Molecular Formula | C13H17F3N4O4S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2-(benzenesulfonamido)-5-(diaminomethylideneamino)-3-(trifluoromethyl)pentanoic acid |
| SMILES | NC(N)=NCCC(C(NS(=O)(=O)c1ccccc1)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C13H17F3N4O4S/c14-13(15,16)9(6-7-19-12(17)18)10(11(21)22)20-25(23,24)8-4-2-1-3-5-8/h1-5,9-10,20H,6-7H2,(H,21,22)(H4,17,18,19) |
| InChIKey | RAUDNMYWEHIXFM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|